C24H21F3N4O6 — CID 144841844
(2E)-3-[formyl-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-[methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)hydrazinylidene]-3-oxopropanoic acid (PubChem CID 144841844) has the molecular formula C24H21F3N4O6 and a molecular weight of 518.45 g/mol. Its IUPAC name is (2E)-3-[formyl-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-[methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)hydrazinylidene]-3-oxopropanoic acid.
| Compound Name | (2E)-3-[formyl-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-[methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)hydrazinylidene]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 144841844 |
| Molecular Formula | C24H21F3N4O6 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (2E)-3-[formyl-[5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-[methyl-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)hydrazinylidene]-3-oxopropanoic acid |
| SMILES | CN(/N=C(/C(=O)O)C(=O)N(C=O)C1CCCc2c1cccc2C(F)(F)F)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C24H21F3N4O6/c1-29-18-10-9-13(11-19(18)37-23(29)36)30(2)28-20(22(34)35)21(33)31(12-32)17-8-4-5-14-15(17)6-3-7-16(14)24(25,26)27/h3,6-7,9-12,17H,4-5,8H2,1-2H3,(H,34,35)/b28-20+ |
| InChIKey | DIAHDIRBATUYKD-VFCFBJKWSA-N |
| XLogP | 3.09 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|