C21H22N4O2 — CID 144842705
N-(4-cyclohexa-1,3-dien-1-yl-3-pyridinyl)-2-[[cyclopropyl(hydroxy)methyl]amino]pyridine-4-carboxamide (PubChem CID 144842705) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(4-cyclohexa-1,3-dien-1-yl-3-pyridinyl)-2-[[cyclopropyl(hydroxy)methyl]amino]pyridine-4-carboxamide.
| Compound Name | N-(4-cyclohexa-1,3-dien-1-yl-3-pyridinyl)-2-[[cyclopropyl(hydroxy)methyl]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 144842705 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-(4-cyclohexa-1,3-dien-1-yl-3-pyridinyl)-2-[[cyclopropyl(hydroxy)methyl]amino]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cnccc1C1=CC=CCC1)c1ccnc(NC(O)C2CC2)c1 |
| InChI | InChI=1S/C21H22N4O2/c26-20(15-6-7-15)25-19-12-16(8-11-23-19)21(27)24-18-13-22-10-9-17(18)14-4-2-1-3-5-14/h1-2,4,8-13,15,20,26H,3,5-7H2,(H,23,25)(H,24,27) |
| InChIKey | HGUZVXYUNPUFQP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|