C33H30BNO2 — CID 144844294
[4-[2-[cyclohexa-2,4-dien-1-yl-(9,9-dimethylfluoren-2-yl)amino]phenyl]phenyl]boronic acid (PubChem CID 144844294) has the molecular formula C33H30BNO2 and a molecular weight of 483.42 g/mol. Its IUPAC name is [4-[2-[cyclohexa-2,4-dien-1-yl-(9,9-dimethylfluoren-2-yl)amino]phenyl]phenyl]boronic acid.
| Compound Name | [4-[2-[cyclohexa-2,4-dien-1-yl-(9,9-dimethylfluoren-2-yl)amino]phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 144844294 |
| Molecular Formula | C33H30BNO2 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [4-[2-[cyclohexa-2,4-dien-1-yl-(9,9-dimethylfluoren-2-yl)amino]phenyl]phenyl]boronic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccccc3-c3ccc(B(O)O)cc3)C3C=CC=CC3)cc21 |
| InChI | InChI=1S/C33H30BNO2/c1-33(2)30-14-8-6-13-28(30)29-21-20-26(22-31(29)33)35(25-10-4-3-5-11-25)32-15-9-7-12-27(32)23-16-18-24(19-17-23)34(36)37/h3-10,12-22,25,36-37H,11H2,1-2H3 |
| InChIKey | IVGBTLLPJUHXPI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|