C24H36Cl2N2O — CID 144845813
2,6-dichloro-N-(4-methylpentyl)-N-propylaniline;ethane;N-phenylformamide (PubChem CID 144845813) has the molecular formula C24H36Cl2N2O and a molecular weight of 439.47 g/mol. Its IUPAC name is 2,6-dichloro-N-(4-methylpentyl)-N-propylaniline;ethane;N-phenylformamide.
| Compound Name | 2,6-dichloro-N-(4-methylpentyl)-N-propylaniline;ethane;N-phenylformamide |
|---|---|
| PubChem CID | 144845813 |
| Molecular Formula | C24H36Cl2N2O |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2,6-dichloro-N-(4-methylpentyl)-N-propylaniline;ethane;N-phenylformamide |
| SMILES | CC.CCCN(CCCC(C)C)c1c(Cl)cccc1Cl.O=CNc1ccccc1 |
| InChI | InChI=1S/C15H23Cl2N.C7H7NO.C2H6/c1-4-10-18(11-6-7-12(2)3)15-13(16)8-5-9-14(15)17;9-6-8-7-4-2-1-3-5-7;1-2/h5,8-9,12H,4,6-7,10-11H2,1-3H3;1-6H,(H,8,9);1-2H3 |
| InChIKey | OOQSNLIQMJFTOJ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|