C25H44N4O3 — CID 144846472
1-[2-methyl-6-[6-methyl-1-[1-(methylamino)ethyl]piperidin-3-yl]-4-(oxolane-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 144846472) has the molecular formula C25H44N4O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is 1-[2-methyl-6-[6-methyl-1-[1-(methylamino)ethyl]piperidin-3-yl]-4-(oxolane-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[2-methyl-6-[6-methyl-1-[1-(methylamino)ethyl]piperidin-3-yl]-4-(oxolane-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 144846472 |
| Molecular Formula | C25H44N4O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | 1-[2-methyl-6-[6-methyl-1-[1-(methylamino)ethyl]piperidin-3-yl]-4-(oxolane-2-carbonyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CNC(C)N1CC(C2CCC3C(C2)N(C(=O)C2CCCO2)CC(C)N3C(C)=O)CCC1C |
| InChI | InChI=1S/C25H44N4O3/c1-16-8-9-21(15-27(16)18(3)26-5)20-10-11-22-23(13-20)28(14-17(2)29(22)19(4)30)25(31)24-7-6-12-32-24/h16-18,20-24,26H,6-15H2,1-5H3 |
| InChIKey | GYPCXZWMAZRUGU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |