C8H14N4 — CID 144846555
ethane;(Z)-N-(3-ethenyl-1,2,4-triazol-4-yl)ethanimine (PubChem CID 144846555) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is ethane;(Z)-N-(3-ethenyl-1,2,4-triazol-4-yl)ethanimine.
| Compound Name | ethane;(Z)-N-(3-ethenyl-1,2,4-triazol-4-yl)ethanimine |
|---|---|
| PubChem CID | 144846555 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | ethane;(Z)-N-(3-ethenyl-1,2,4-triazol-4-yl)ethanimine |
| SMILES | C=Cc1nncn1/N=C\C.CC |
| InChI | InChI=1S/C6H8N4.C2H6/c1-3-6-9-7-5-10(6)8-4-2;1-2/h3-5H,1H2,2H3;1-2H3/b8-4-; |
| InChIKey | SGUUFWLGYPHHQU-ZYFYRQFPSA-N |
| XLogP | 1.80 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|