C24H29F3N7OS+ — CID 144847702
[2-amino-4-(dimethylamino)-5-[[(7S)-7-[methyl(3,3,3-trifluoropropyl)carbamoyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium (PubChem CID 144847702) has the molecular formula C24H29F3N7OS+ and a molecular weight of 520.61 g/mol. Its IUPAC name is [2-amino-4-(dimethylamino)-5-[[(7S)-7-[methyl(3,3,3-trifluoropropyl)carbamoyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium.
| Compound Name | [2-amino-4-(dimethylamino)-5-[[(7S)-7-[methyl(3,3,3-trifluoropropyl)carbamoyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium |
|---|---|
| PubChem CID | 144847702 |
| Molecular Formula | C24H29F3N7OS+ |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [2-amino-4-(dimethylamino)-5-[[(7S)-7-[methyl(3,3,3-trifluoropropyl)carbamoyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium |
| SMILES | CN(CCC(F)(F)F)C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc(C=[NH2+])c(N)cc4N(C)C)c23)C1 |
| InChI | InChI=1S/C24H28F3N7OS/c1-33(2)18-10-16(29)14(11-28)8-17(18)32-21-20-15-5-4-13(9-19(15)36-22(20)31-12-30-21)23(35)34(3)7-6-24(25,26)27/h8,10-13,28H,4-7,9,29H2,1-3H3,(H,30,31,32)/p+1/t13-/m0/s1 |
| InChIKey | MSDPVKSGPVJRHE-ZDUSSCGKSA-O |
| XLogP | 2.78 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|