C21H18F3N5O2S2 — CID 90014527
4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 90014527) has the molecular formula C21H18F3N5O2S2 and a molecular weight of 493.54 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 90014527 |
| Molecular Formula | C21H18F3N5O2S2 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-[(2-oxo-3H-1,3-benzothiazol-6-yl)amino]-N-(3,3,3-trifluoropropyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(NCCC(F)(F)F)C1CCc2c(sc3ncnc(Nc4ccc5[nH]c(=O)sc5c4)c23)C1 |
| InChI | InChI=1S/C21H18F3N5O2S2/c22-21(23,24)5-6-25-18(30)10-1-3-12-14(7-10)32-19-16(12)17(26-9-27-19)28-11-2-4-13-15(8-11)33-20(31)29-13/h2,4,8-10H,1,3,5-7H2,(H,25,30)(H,29,31)(H,26,27,28) |
| InChIKey | OYPRORYSWJZJSE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |