C17H16ClN5OS — CID 144849089
[4-[6-[[(5-chloropyrimidin-2-yl)amino]methyl]-2-methylpyrimidin-4-yl]oxyphenyl]methanethiol (PubChem CID 144849089) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is [4-[6-[[(5-chloropyrimidin-2-yl)amino]methyl]-2-methylpyrimidin-4-yl]oxyphenyl]methanethiol.
| Compound Name | [4-[6-[[(5-chloropyrimidin-2-yl)amino]methyl]-2-methylpyrimidin-4-yl]oxyphenyl]methanethiol |
|---|---|
| PubChem CID | 144849089 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | [4-[6-[[(5-chloropyrimidin-2-yl)amino]methyl]-2-methylpyrimidin-4-yl]oxyphenyl]methanethiol |
| SMILES | Cc1nc(CNc2ncc(Cl)cn2)cc(Oc2ccc(CS)cc2)n1 |
| InChI | InChI=1S/C17H16ClN5OS/c1-11-22-14(9-21-17-19-7-13(18)8-20-17)6-16(23-11)24-15-4-2-12(10-25)3-5-15/h2-8,25H,9-10H2,1H3,(H,19,20,21) |
| InChIKey | ZPTXRJAMPKZMMF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|