C17H18N6OS — CID 146590158
[4-[2-(methylamino)-6-[(pyrimidin-2-ylamino)methyl]pyrimidin-4-yl]oxyphenyl]methanethiol (PubChem CID 146590158) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is [4-[2-(methylamino)-6-[(pyrimidin-2-ylamino)methyl]pyrimidin-4-yl]oxyphenyl]methanethiol.
| Compound Name | [4-[2-(methylamino)-6-[(pyrimidin-2-ylamino)methyl]pyrimidin-4-yl]oxyphenyl]methanethiol |
|---|---|
| PubChem CID | 146590158 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [4-[2-(methylamino)-6-[(pyrimidin-2-ylamino)methyl]pyrimidin-4-yl]oxyphenyl]methanethiol |
| SMILES | CNc1nc(CNc2ncccn2)cc(Oc2ccc(CS)cc2)n1 |
| InChI | InChI=1S/C17H18N6OS/c1-18-16-22-13(10-21-17-19-7-2-8-20-17)9-15(23-16)24-14-5-3-12(11-25)4-6-14/h2-9,25H,10-11H2,1H3,(H,18,22,23)(H,19,20,21) |
| InChIKey | TWXGAZWAAKBEPJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|