C15H13N5O — CID 86804405
N-[(4-pyrazin-2-yloxyphenyl)methyl]pyrimidin-2-amine (PubChem CID 86804405) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[(4-pyrazin-2-yloxyphenyl)methyl]pyrimidin-2-amine.
| Compound Name | N-[(4-pyrazin-2-yloxyphenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86804405 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[(4-pyrazin-2-yloxyphenyl)methyl]pyrimidin-2-amine |
| SMILES | c1cnc(NCc2ccc(Oc3cnccn3)cc2)nc1 |
| InChI | InChI=1S/C15H13N5O/c1-6-18-15(19-7-1)20-10-12-2-4-13(5-3-12)21-14-11-16-8-9-17-14/h1-9,11H,10H2,(H,18,19,20) |
| InChIKey | CUQQWLUIPLVWIX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |