C23H25N3O3 — CID 119139118
tert-butyl 4-[[(4-pyrazin-2-yloxyphenyl)methylamino]methyl]benzoate (PubChem CID 119139118) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is tert-butyl 4-[[(4-pyrazin-2-yloxyphenyl)methylamino]methyl]benzoate.
| Compound Name | tert-butyl 4-[[(4-pyrazin-2-yloxyphenyl)methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 119139118 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | tert-butyl 4-[[(4-pyrazin-2-yloxyphenyl)methylamino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CNCc2ccc(Oc3cnccn3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-23(2,3)29-22(27)19-8-4-17(5-9-19)14-25-15-18-6-10-20(11-7-18)28-21-16-24-12-13-26-21/h4-13,16,25H,14-15H2,1-3H3 |
| InChIKey | MPFATYXQMIWDCE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |