C18H14FN3O3 — CID 166224546
2-fluoro-5-[(4-pyrazin-2-yloxyphenyl)methylamino]benzoic acid (PubChem CID 166224546) has the molecular formula C18H14FN3O3 and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-fluoro-5-[(4-pyrazin-2-yloxyphenyl)methylamino]benzoic acid.
| Compound Name | 2-fluoro-5-[(4-pyrazin-2-yloxyphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 166224546 |
| Molecular Formula | C18H14FN3O3 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-fluoro-5-[(4-pyrazin-2-yloxyphenyl)methylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NCc2ccc(Oc3cnccn3)cc2)ccc1F |
| InChI | InChI=1S/C18H14FN3O3/c19-16-6-3-13(9-15(16)18(23)24)22-10-12-1-4-14(5-2-12)25-17-11-20-7-8-21-17/h1-9,11,22H,10H2,(H,23,24) |
| InChIKey | GEEMTLNUWRUOQE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |