C30H35FN2O2 — CID 144850073
4-[(1-benzhydryl-3-methylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzamide;ethane (PubChem CID 144850073) has the molecular formula C30H35FN2O2 and a molecular weight of 474.62 g/mol. Its IUPAC name is 4-[(1-benzhydryl-3-methylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzamide;ethane.
| Compound Name | 4-[(1-benzhydryl-3-methylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzamide;ethane |
|---|---|
| PubChem CID | 144850073 |
| Molecular Formula | C30H35FN2O2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 4-[(1-benzhydryl-3-methylazetidin-3-yl)methoxy]-5-cyclopropyl-2-fluorobenzamide;ethane |
| SMILES | CC.CC1(COc2cc(F)c(C(N)=O)cc2C2CC2)CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H29FN2O2.C2H6/c1-28(18-33-25-15-24(29)23(27(30)32)14-22(25)19-12-13-19)16-31(17-28)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21;1-2/h2-11,14-15,19,26H,12-13,16-18H2,1H3,(H2,30,32);1-2H3 |
| InChIKey | BRUUSCBFKPWTHN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |