C34H46N2O12 — CID 144851244
methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-formyl-5-heptoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate (PubChem CID 144851244) has the molecular formula C34H46N2O12 and a molecular weight of 674.74 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-formyl-5-heptoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate.
| Compound Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-formyl-5-heptoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate |
|---|---|
| PubChem CID | 144851244 |
| Molecular Formula | C34H46N2O12 |
| Molecular Weight | 674.74 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-formyl-5-heptoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)anilino]acetate |
| SMILES | CCCCCCCOc1cc(OCCOc2ccccc2N(CC(=O)OC)CC(=O)OC)c(N(CC(=O)OC)CC(=O)OC)cc1C=O |
| InChI | InChI=1S/C34H46N2O12/c1-6-7-8-9-12-15-46-29-19-30(27(18-25(29)24-37)36(22-33(40)44-4)23-34(41)45-5)48-17-16-47-28-14-11-10-13-26(28)35(20-31(38)42-2)21-32(39)43-3/h10-11,13-14,18-19,24H,6-9,12,15-17,20-23H2,1-5H3 |
| InChIKey | WKVBPVVXNZBJEX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 156.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|