C40H44N2O12 — CID 54313950
methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-phenylmethoxyanilino]acetate (PubChem CID 54313950) has the molecular formula C40H44N2O12 and a molecular weight of 744.79 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-phenylmethoxyanilino]acetate.
| Compound Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-phenylmethoxyanilino]acetate |
|---|---|
| PubChem CID | 54313950 |
| Molecular Formula | C40H44N2O12 |
| Molecular Weight | 744.79 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-phenylmethoxyanilino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1cc(OCc2ccccc2)ccc1OCCOc1ccc(OCc2ccccc2)cc1N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C40H44N2O12/c1-47-37(43)23-41(24-38(44)48-2)33-21-31(53-27-29-11-7-5-8-12-29)15-17-35(33)51-19-20-52-36-18-16-32(54-28-30-13-9-6-10-14-30)22-34(36)42(25-39(45)49-3)26-40(46)50-4/h5-18,21-22H,19-20,23-28H2,1-4H3 |
| InChIKey | SMVJMRKGPUMQLH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 148.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|