C33H37FN2O11 — CID 102005769
methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-3-fluoro-N-(2-methoxy-2-oxoethyl)anilino]acetate (PubChem CID 102005769) has the molecular formula C33H37FN2O11 and a molecular weight of 656.66 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-3-fluoro-N-(2-methoxy-2-oxoethyl)anilino]acetate.
| Compound Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-3-fluoro-N-(2-methoxy-2-oxoethyl)anilino]acetate |
|---|---|
| PubChem CID | 102005769 |
| Molecular Formula | C33H37FN2O11 |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-phenylmethoxyphenoxy]ethoxy]-3-fluoro-N-(2-methoxy-2-oxoethyl)anilino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1cc(OCc2ccccc2)ccc1OCCOc1c(F)cccc1N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C33H37FN2O11/c1-41-29(37)18-35(19-30(38)42-2)26-12-8-11-25(34)33(26)46-16-15-45-28-14-13-24(47-22-23-9-6-5-7-10-23)17-27(28)36(20-31(39)43-3)21-32(40)44-4/h5-14,17H,15-16,18-22H2,1-4H3 |
| InChIKey | OKDJPOYUBTXUTO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|