C27H31FN2O11 — CID 102005778
methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-formyl-N-(2-methoxy-2-oxoethyl)anilino]acetate (PubChem CID 102005778) has the molecular formula C27H31FN2O11 and a molecular weight of 578.55 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-formyl-N-(2-methoxy-2-oxoethyl)anilino]acetate.
| Compound Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-formyl-N-(2-methoxy-2-oxoethyl)anilino]acetate |
|---|---|
| PubChem CID | 102005778 |
| Molecular Formula | C27H31FN2O11 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-formyl-N-(2-methoxy-2-oxoethyl)anilino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1ccc(F)cc1OCCOc1cc(C=O)ccc1N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C27H31FN2O11/c1-36-24(32)13-29(14-25(33)37-2)20-7-5-18(17-31)11-22(20)40-9-10-41-23-12-19(28)6-8-21(23)30(15-26(34)38-3)16-27(35)39-4/h5-8,11-12,17H,9-10,13-16H2,1-4H3 |
| InChIKey | JHAVOHSTPHMJEQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|