C27H35N3O11 — CID 58545387
methyl 2-[2-[2-[5-amino-2-[bis(2-methoxy-2-oxoethyl)amino]-4-hydroxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-methylanilino]acetate (PubChem CID 58545387) has the molecular formula C27H35N3O11 and a molecular weight of 577.59 g/mol. Its IUPAC name is methyl 2-[2-[2-[5-amino-2-[bis(2-methoxy-2-oxoethyl)amino]-4-hydroxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-methylanilino]acetate.
| Compound Name | methyl 2-[2-[2-[5-amino-2-[bis(2-methoxy-2-oxoethyl)amino]-4-hydroxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-methylanilino]acetate |
|---|---|
| PubChem CID | 58545387 |
| Molecular Formula | C27H35N3O11 |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | methyl 2-[2-[2-[5-amino-2-[bis(2-methoxy-2-oxoethyl)amino]-4-hydroxyphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-methylanilino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1ccc(C)cc1OCCOc1cc(N)c(O)cc1N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C27H35N3O11/c1-17-6-7-19(29(13-24(32)36-2)14-25(33)37-3)22(10-17)40-8-9-41-23-11-18(28)21(31)12-20(23)30(15-26(34)38-4)16-27(35)39-5/h6-7,10-12,31H,8-9,13-16,28H2,1-5H3 |
| InChIKey | OPUKHAAADHZCQD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 176.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|