C28H35ClN2O10 — CID 42643577
methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-chloro-5-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-methylanilino]acetate (PubChem CID 42643577) has the molecular formula C28H35ClN2O10 and a molecular weight of 595.05 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-chloro-5-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-methylanilino]acetate.
| Compound Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-chloro-5-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-methylanilino]acetate |
|---|---|
| PubChem CID | 42643577 |
| Molecular Formula | C28H35ClN2O10 |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-4-chloro-5-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-5-methylanilino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1cc(C)ccc1OCCOc1cc(C)c(Cl)cc1N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C28H35ClN2O10/c1-18-7-8-23(21(11-18)30(14-25(32)36-3)15-26(33)37-4)40-9-10-41-24-12-19(2)20(29)13-22(24)31(16-27(34)38-5)17-28(35)39-6/h7-8,11-13H,9-10,14-17H2,1-6H3 |
| InChIKey | PSJRNCLVSUFSER-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|