C24H26N2O12 — CID 67817401
4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]-5-methylphenoxy]ethoxy]benzoic acid (PubChem CID 67817401) has the molecular formula C24H26N2O12 and a molecular weight of 534.47 g/mol. Its IUPAC name is 4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]-5-methylphenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]-5-methylphenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 67817401 |
| Molecular Formula | C24H26N2O12 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 4-[bis(carboxymethyl)amino]-3-[2-[2-[bis(carboxymethyl)amino]-5-methylphenoxy]ethoxy]benzoic acid |
| SMILES | Cc1ccc(N(CC(=O)O)CC(=O)O)c(OCCOc2cc(C(=O)O)ccc2N(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C24H26N2O12/c1-14-2-4-16(25(10-20(27)28)11-21(29)30)18(8-14)37-6-7-38-19-9-15(24(35)36)3-5-17(19)26(12-22(31)32)13-23(33)34/h2-5,8-9H,6-7,10-13H2,1H3,(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | WAJNKVNSVZQNFZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 211.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|