C35H42IN3O10 — CID 134913989
methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-3-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]acetate iodide (PubChem CID 134913989) has the molecular formula C35H42IN3O10 and a molecular weight of 791.64 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-3-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]acetate iodide.
| Compound Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-3-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]acetate iodide |
|---|---|
| PubChem CID | 134913989 |
| Molecular Formula | C35H42IN3O10 |
| Molecular Weight | 791.64 g/mol |
| Exact Mass | 791.19 |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-3-methylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]anilino]acetate iodide |
| SMILES | COC(=O)CN(CC(=O)OC)c1ccc(/C=C/c2cc[n+](C)cc2)cc1OCCOc1cccc(C)c1N(CC(=O)OC)CC(=O)OC.[I-] |
| InChI | InChI=1S/C35H42N3O10.HI/c1-25-8-7-9-29(35(25)38(23-33(41)45-5)24-34(42)46-6)47-18-19-48-30-20-27(11-10-26-14-16-36(2)17-15-26)12-13-28(30)37(21-31(39)43-3)22-32(40)44-4;/h7-17,20H,18-19,21-24H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | UBKIRNLMYVCDHY-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 134.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.64 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|