C24H25N2O3+ — CID 6489929
2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 6489929) has the molecular formula C24H25N2O3+ and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 6489929 |
| Molecular Formula | C24H25N2O3+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C/c2cc[n+](C)cc2)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-18-4-9-21(10-5-18)25-24(27)17-29-22-11-8-20(16-23(22)28-3)7-6-19-12-14-26(2)15-13-19/h4-16H,17H2,1-3H3/p+1/b7-6+ |
| InChIKey | HWSZNNZFFMQRBD-VOTSOKGWSA-O |
| XLogP | 4.02 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|