C26H27N3O5 — CID 72696073
(E)-N-(2-amino-4-methylphenyl)-3-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enamide (PubChem CID 72696073) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is (E)-N-(2-amino-4-methylphenyl)-3-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-amino-4-methylphenyl)-3-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72696073 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (E)-N-(2-amino-4-methylphenyl)-3-[3-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=C/C(=O)Nc3ccc(C)cc3N)cc2OC)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-17-4-11-22(21(27)14-17)29-25(30)13-6-18-5-12-23(24(15-18)33-3)34-16-26(31)28-19-7-9-20(32-2)10-8-19/h4-15H,16,27H2,1-3H3,(H,28,31)(H,29,30)/b13-6+ |
| InChIKey | HEEMOKAUTUKYOF-AWNIVKPZSA-N |
| XLogP | 4.26 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|