C24H25N2O4+ — CID 6489932
2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 6489932) has the molecular formula C24H25N2O4+ and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 6489932 |
| Molecular Formula | C24H25N2O4+ |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=C/c3cc[n+](C)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-26-14-12-18(13-15-26)4-5-19-6-11-22(23(16-19)29-3)30-17-24(27)25-20-7-9-21(28-2)10-8-20/h4-16H,17H2,1-3H3/p+1/b5-4+ |
| InChIKey | XUGDNULORZUNMN-SNAWJCMRSA-O |
| XLogP | 3.72 |
| TPSA | 60.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|