C35H48BrFN2O11 — CID 130367995
methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-(5-bromo-2,2,4,4-tetramethylpentoxy)-N-(2-methoxy-2-oxoethyl)anilino]acetate (PubChem CID 130367995) has the molecular formula C35H48BrFN2O11 and a molecular weight of 771.67 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-(5-bromo-2,2,4,4-tetramethylpentoxy)-N-(2-methoxy-2-oxoethyl)anilino]acetate.
| Compound Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-(5-bromo-2,2,4,4-tetramethylpentoxy)-N-(2-methoxy-2-oxoethyl)anilino]acetate |
|---|---|
| PubChem CID | 130367995 |
| Molecular Formula | C35H48BrFN2O11 |
| Molecular Weight | 771.67 g/mol |
| Exact Mass | 770.24 |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-fluorophenoxy]ethoxy]-4-(5-bromo-2,2,4,4-tetramethylpentoxy)-N-(2-methoxy-2-oxoethyl)anilino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)c1ccc(F)cc1OCCOc1cc(OCC(C)(C)CC(C)(C)CBr)ccc1N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C35H48BrFN2O11/c1-34(2,22-36)21-35(3,4)23-50-25-10-12-27(39(19-32(42)46-7)20-33(43)47-8)29(16-25)49-14-13-48-28-15-24(37)9-11-26(28)38(17-30(40)44-5)18-31(41)45-6/h9-12,15-16H,13-14,17-23H2,1-8H3 |
| InChIKey | KNPQPSKOGMJTAT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 139.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|