C15H19BrN2O — CID 144853785
N-[2-(2-bromo-3,4-dimethyl-1,4-dihydroquinolin-6-yl)ethyl]acetamide (PubChem CID 144853785) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is N-[2-(2-bromo-3,4-dimethyl-1,4-dihydroquinolin-6-yl)ethyl]acetamide.
| Compound Name | N-[2-(2-bromo-3,4-dimethyl-1,4-dihydroquinolin-6-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 144853785 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[2-(2-bromo-3,4-dimethyl-1,4-dihydroquinolin-6-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc2c(c1)C(C)C(C)=C(Br)N2 |
| InChI | InChI=1S/C15H19BrN2O/c1-9-10(2)15(16)18-14-5-4-12(8-13(9)14)6-7-17-11(3)19/h4-5,8-9,18H,6-7H2,1-3H3,(H,17,19) |
| InChIKey | XGDMFHRMIDYFRT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|