C23H19ClN10O — CID 144858153
(12R)-12-[(4-chlorophenyl)methyl]-9-methyl-6-[2-(1H-pyrazol-5-ylamino)pyrimidin-4-yl]-2,3,9,11,13-pentazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-10-one (PubChem CID 144858153) has the molecular formula C23H19ClN10O and a molecular weight of 486.93 g/mol. Its IUPAC name is (12R)-12-[(4-chlorophenyl)methyl]-9-methyl-6-[2-(1H-pyrazol-5-ylamino)pyrimidin-4-yl]-2,3,9,11,13-pentazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-10-one.
| Compound Name | (12R)-12-[(4-chlorophenyl)methyl]-9-methyl-6-[2-(1H-pyrazol-5-ylamino)pyrimidin-4-yl]-2,3,9,11,13-pentazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-10-one |
|---|---|
| PubChem CID | 144858153 |
| Molecular Formula | C23H19ClN10O |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (12R)-12-[(4-chlorophenyl)methyl]-9-methyl-6-[2-(1H-pyrazol-5-ylamino)pyrimidin-4-yl]-2,3,9,11,13-pentazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-10-one |
| SMILES | CN1C(=O)N[C@H](Cc2ccc(Cl)cc2)c2nnc3cc(-c4ccnc(Nc5ccn[nH]5)n4)cc1n23 |
| InChI | InChI=1S/C23H19ClN10O/c1-33-20-12-14(16-6-8-25-22(27-16)29-18-7-9-26-30-18)11-19-31-32-21(34(19)20)17(28-23(33)35)10-13-2-4-15(24)5-3-13/h2-9,11-12,17H,10H2,1H3,(H,28,35)(H2,25,26,27,29,30)/t17-/m1/s1 |
| InChIKey | OHSSGKMBZZMMDR-QGZVFWFLSA-N |
| XLogP | 3.75 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |