C13H16N2S — CID 144859444
N-[3-[3-[methyl(prop-2-ynyl)amino]prop-1-en-2-yl]phenyl]thiohydroxylamine (PubChem CID 144859444) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-[3-[3-[methyl(prop-2-ynyl)amino]prop-1-en-2-yl]phenyl]thiohydroxylamine.
| Compound Name | N-[3-[3-[methyl(prop-2-ynyl)amino]prop-1-en-2-yl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 144859444 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-[3-[3-[methyl(prop-2-ynyl)amino]prop-1-en-2-yl]phenyl]thiohydroxylamine |
| SMILES | C#CCN(C)CC(=C)c1cccc(NS)c1 |
| InChI | InChI=1S/C13H16N2S/c1-4-8-15(3)10-11(2)12-6-5-7-13(9-12)14-16/h1,5-7,9,14,16H,2,8,10H2,3H3 |
| InChIKey | UNKLZIYOHNFCSQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|