C20H21BN4 — CID 144859729
1-[1-[(4-methylphenyl)methyl]pyrrolo[2,3-b]pyridin-4-yl]-1,4-azaborinane-4-carbonitrile (PubChem CID 144859729) has the molecular formula C20H21BN4 and a molecular weight of 328.23 g/mol. Its IUPAC name is 1-[1-[(4-methylphenyl)methyl]pyrrolo[2,3-b]pyridin-4-yl]-1,4-azaborinane-4-carbonitrile.
| Compound Name | 1-[1-[(4-methylphenyl)methyl]pyrrolo[2,3-b]pyridin-4-yl]-1,4-azaborinane-4-carbonitrile |
|---|---|
| PubChem CID | 144859729 |
| Molecular Formula | C20H21BN4 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-[1-[(4-methylphenyl)methyl]pyrrolo[2,3-b]pyridin-4-yl]-1,4-azaborinane-4-carbonitrile |
| SMILES | Cc1ccc(Cn2ccc3c(N4CCB(C#N)CC4)ccnc32)cc1 |
| InChI | InChI=1S/C20H21BN4/c1-16-2-4-17(5-3-16)14-25-11-7-18-19(6-10-23-20(18)25)24-12-8-21(15-22)9-13-24/h2-7,10-11H,8-9,12-14H2,1H3 |
| InChIKey | HAHHUKYRTLXSSO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|