C26H30N4O6S — CID 144862909
6-amino-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide;methanethiol;methyl 4-hydroxybutanoate (PubChem CID 144862909) has the molecular formula C26H30N4O6S and a molecular weight of 526.62 g/mol. Its IUPAC name is 6-amino-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide;methanethiol;methyl 4-hydroxybutanoate.
| Compound Name | 6-amino-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide;methanethiol;methyl 4-hydroxybutanoate |
|---|---|
| PubChem CID | 144862909 |
| Molecular Formula | C26H30N4O6S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 6-amino-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide;methanethiol;methyl 4-hydroxybutanoate |
| SMILES | COC(=O)CCCO.CS.Cc1ccoc1C(=O)Nc1cccc(C#Cc2cc(C(N)=O)cnc2N)c1 |
| InChI | InChI=1S/C20H16N4O3.C5H10O3.CH4S/c1-12-7-8-27-17(12)20(26)24-16-4-2-3-13(9-16)5-6-14-10-15(19(22)25)11-23-18(14)21;1-8-5(7)3-2-4-6;1-2/h2-4,7-11H,1H3,(H2,21,23)(H2,22,25)(H,24,26);6H,2-4H2,1H3;2H,1H3 |
| InChIKey | MKPFTWMGVGSPQE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 170.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|