C21H15N3O4S — CID 87648489
3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-5-[methyl(sulfanylidene)azaniumyl]carbonylpyridin-4-olate (PubChem CID 87648489) has the molecular formula C21H15N3O4S and a molecular weight of 405.44 g/mol. Its IUPAC name is 3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-5-[methyl(sulfanylidene)azaniumyl]carbonylpyridin-4-olate.
| Compound Name | 3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-5-[methyl(sulfanylidene)azaniumyl]carbonylpyridin-4-olate |
|---|---|
| PubChem CID | 87648489 |
| Molecular Formula | C21H15N3O4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 3-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]-5-[methyl(sulfanylidene)azaniumyl]carbonylpyridin-4-olate |
| SMILES | Cc1ccoc1C(=O)Nc1cccc(C#Cc2cncc(C(=O)[N+](C)=S)c2[O-])c1 |
| InChI | InChI=1S/C21H15N3O4S/c1-13-8-9-28-19(13)20(26)23-16-5-3-4-14(10-16)6-7-15-11-22-12-17(18(15)25)21(27)24(2)29/h3-5,8-12H,1-2H3,(H-,22,23,25,26,27) |
| InChIKey | HKQBXLXENJHEDO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|