C31H28N4O6S — CID 87165111
2-[3-[N-[5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]propylamino]acetic acid (PubChem CID 87165111) has the molecular formula C31H28N4O6S and a molecular weight of 584.65 g/mol. Its IUPAC name is 2-[3-[N-[5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]propylamino]acetic acid.
| Compound Name | 2-[3-[N-[5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]propylamino]acetic acid |
|---|---|
| PubChem CID | 87165111 |
| Molecular Formula | C31H28N4O6S |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 2-[3-[N-[5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]propylamino]acetic acid |
| SMILES | Cc1ccoc1C(=O)Nc1cccc(C#Cc2cncc(C(=O)N=[S@](=O)(CCCNCC(=O)O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H28N4O6S/c1-22-13-15-41-29(22)31(39)34-26-8-5-7-23(18-26)11-12-24-17-25(20-33-19-24)30(38)35-42(40,27-9-3-2-4-10-27)16-6-14-32-21-28(36)37/h2-5,7-10,13,15,17-20,32H,6,14,16,21H2,1H3,(H,34,39)(H,36,37)/t42-/m0/s1 |
| InChIKey | BWXIVLSKMUCHFX-WBCKFURZSA-N |
| XLogP | 4.37 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|