C31H29N5O5S — CID 76585249
5-[N-[5-[2-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]pentanoic acid (PubChem CID 76585249) has the molecular formula C31H29N5O5S and a molecular weight of 583.67 g/mol. Its IUPAC name is 5-[N-[5-[2-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]pentanoic acid.
| Compound Name | 5-[N-[5-[2-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]pentanoic acid |
|---|---|
| PubChem CID | 76585249 |
| Molecular Formula | C31H29N5O5S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 5-[N-[5-[2-[3-[(2,5-dimethylpyrazole-3-carbonyl)amino]phenyl]ethynyl]pyridine-3-carbonyl]-S-phenylsulfonimidoyl]pentanoic acid |
| SMILES | Cc1cc(C(=O)Nc2cccc(C#Cc3cncc(C(=O)N=S(=O)(CCCCC(=O)O)c4ccccc4)c3)c2)n(C)n1 |
| InChI | InChI=1S/C31H29N5O5S/c1-22-17-28(36(2)34-22)31(40)33-26-10-8-9-23(19-26)14-15-24-18-25(21-32-20-24)30(39)35-42(41,16-7-6-13-29(37)38)27-11-4-3-5-12-27/h3-5,8-12,17-21H,6-7,13,16H2,1-2H3,(H,33,40)(H,37,38) |
| InChIKey | VPNIQESLULSSEG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|