C29H24N4O5S — CID 90729944
N-[[2-(methylamino)-2-oxoethylidene]-oxo-phenyl-λ6-sulfanyl]-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide (PubChem CID 90729944) has the molecular formula C29H24N4O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is N-[[2-(methylamino)-2-oxoethylidene]-oxo-phenyl-λ6-sulfanyl]-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide.
| Compound Name | N-[[2-(methylamino)-2-oxoethylidene]-oxo-phenyl-λ6-sulfanyl]-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90729944 |
| Molecular Formula | C29H24N4O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | N-[[2-(methylamino)-2-oxoethylidene]-oxo-phenyl-λ6-sulfanyl]-5-[2-[3-[(3-methylfuran-2-carbonyl)amino]phenyl]ethynyl]pyridine-3-carboxamide |
| SMILES | CNC(=O)C=S(=O)(NC(=O)c1cncc(C#Cc2cccc(NC(=O)c3occc3C)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H24N4O5S/c1-20-13-14-38-27(20)29(36)32-24-8-6-7-21(16-24)11-12-22-15-23(18-31-17-22)28(35)33-39(37,19-26(34)30-2)25-9-4-3-5-10-25/h3-10,13-19H,1-2H3,(H,30,34)(H,32,36)(H,33,35,37) |
| InChIKey | JAKWYNIUHVSINK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|