C31H36N4O4 — CID 144862993
tert-butyl N-[[4-[6-[4-(4-propoxybutanoyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]carbamate (PubChem CID 144862993) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is tert-butyl N-[[4-[6-[4-(4-propoxybutanoyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[6-[4-(4-propoxybutanoyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 144862993 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | tert-butyl N-[[4-[6-[4-(4-propoxybutanoyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]methyl]carbamate |
| SMILES | CCCOCCCC(=O)c1ccc(-c2cc3c(-c4ccc(CNC(=O)OC(C)(C)C)cc4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C31H36N4O4/c1-5-16-38-17-6-7-27(36)23-14-12-22(13-15-23)26-18-25-28(33-20-34-29(25)35-26)24-10-8-21(9-11-24)19-32-30(37)39-31(2,3)4/h8-15,18,20H,5-7,16-17,19H2,1-4H3,(H,32,37)(H,33,34,35) |
| InChIKey | BKMMUAFYQADZRO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|