C7H10F2N2 — CID 144864764
3,5-difluoro-N,1-dimethyl-2H-pyridin-6-amine (PubChem CID 144864764) has the molecular formula C7H10F2N2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3,5-difluoro-N,1-dimethyl-2H-pyridin-6-amine.
| Compound Name | 3,5-difluoro-N,1-dimethyl-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 144864764 |
| Molecular Formula | C7H10F2N2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 3,5-difluoro-N,1-dimethyl-2H-pyridin-6-amine |
| SMILES | CNC1=C(F)C=C(F)CN1C |
| InChI | InChI=1S/C7H10F2N2/c1-10-7-6(9)3-5(8)4-11(7)2/h3,10H,4H2,1-2H3 |
| InChIKey | UIQIITLEPQVJKH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |