C9H16OS — CID 144866827
ethane;2-methoxycyclohexa-1,5-diene-1-thiol (PubChem CID 144866827) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is ethane;2-methoxycyclohexa-1,5-diene-1-thiol.
| Compound Name | ethane;2-methoxycyclohexa-1,5-diene-1-thiol |
|---|---|
| PubChem CID | 144866827 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | ethane;2-methoxycyclohexa-1,5-diene-1-thiol |
| SMILES | CC.COC1=C(S)C=CCC1 |
| InChI | InChI=1S/C7H10OS.C2H6/c1-8-6-4-2-3-5-7(6)9;1-2/h3,5,9H,2,4H2,1H3;1-2H3 |
| InChIKey | JJCWBXHYUHZMSK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|