C26H30BF4N3O6 — CID 144867148
2-[(4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (PubChem CID 144867148) has the molecular formula C26H30BF4N3O6 and a molecular weight of 567.35 g/mol. Its IUPAC name is 2-[(4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-[(4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144867148 |
| Molecular Formula | C26H30BF4N3O6 |
| Molecular Weight | 567.35 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 2-[(4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| SMILES | CC1(C)OB(c2cnc(O[C@H]3CCN(C(=O)Cc4ccc(OC(F)(F)F)cc4)CC3F)c(C(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C26H30BF4N3O6/c1-24(2)25(3,4)40-27(39-24)16-12-18(22(32)36)23(33-13-16)37-20-9-10-34(14-19(20)28)21(35)11-15-5-7-17(8-6-15)38-26(29,30)31/h5-8,12-13,19-20H,9-11,14H2,1-4H3,(H2,32,36)/t19?,20-/m0/s1 |
| InChIKey | LWNYNIHQVJXBBT-ANYOKISRSA-N |
| XLogP | 2.94 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|