C27H31BF4N2O6 — CID 140814436
2-[(3R,4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 140814436) has the molecular formula C27H31BF4N2O6 and a molecular weight of 566.36 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 140814436 |
| Molecular Formula | C27H31BF4N2O6 |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]piperidin-4-yl]oxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)OB(c2ccc(O[C@H]3CCN(C(=O)Cc4ccc(OC(F)(F)F)cc4)C[C@H]3F)c(C(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C27H31BF4N2O6/c1-25(2)26(3,4)40-28(39-25)17-7-10-21(19(14-17)24(33)36)37-22-11-12-34(15-20(22)29)23(35)13-16-5-8-18(9-6-16)38-27(30,31)32/h5-10,14,20,22H,11-13,15H2,1-4H3,(H2,33,36)/t20-,22+/m1/s1 |
| InChIKey | SAAPZGJXWRVQLE-IRLDBZIGSA-N |
| XLogP | 3.54 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|