C18H23F3N2O4 — CID 67443015
tert-butyl-[(3S)-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 67443015) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is tert-butyl-[(3S)-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S)-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67443015 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | tert-butyl-[(3S)-1-[2-[4-(trifluoromethoxy)phenyl]acetyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1CCN(C(=O)Cc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H23F3N2O4/c1-17(2,3)23(16(25)26)13-8-9-22(11-13)15(24)10-12-4-6-14(7-5-12)27-18(19,20)21/h4-7,13H,8-11H2,1-3H3,(H,25,26)/t13-/m0/s1 |
| InChIKey | GCMHODBUDCOHTE-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |