C28H32BF3N2O7 — CID 140814412
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[(1S,5S)-3-[2-[4-(trifluoromethoxy)phenyl]acetyl]-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide (PubChem CID 140814412) has the molecular formula C28H32BF3N2O7 and a molecular weight of 576.38 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[(1S,5S)-3-[2-[4-(trifluoromethoxy)phenyl]acetyl]-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[(1S,5S)-3-[2-[4-(trifluoromethoxy)phenyl]acetyl]-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide |
|---|---|
| PubChem CID | 140814412 |
| Molecular Formula | C28H32BF3N2O7 |
| Molecular Weight | 576.38 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[[(1S,5S)-3-[2-[4-(trifluoromethoxy)phenyl]acetyl]-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide |
| SMILES | CC1(C)OB(c2ccc(OC3[C@@H]4CO[C@H]3CN(C(=O)Cc3ccc(OC(F)(F)F)cc3)C4)c(C(N)=O)c2)OC1(C)C |
| InChI | InChI=1S/C28H32BF3N2O7/c1-26(2)27(3,4)41-29(40-26)18-7-10-21(20(12-18)25(33)36)38-24-17-13-34(14-22(24)37-15-17)23(35)11-16-5-8-19(9-6-16)39-28(30,31)32/h5-10,12,17,22,24H,11,13-15H2,1-4H3,(H2,33,36)/t17-,22-,24?/m0/s1 |
| InChIKey | UOGDCFIDHKJEAV-LDQFBORQSA-N |
| XLogP | 2.83 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|