C28H36N4O4 — CID 144867470
3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[phenoxy(propan-2-yl)amino]methyl]phenyl]propanoic acid (PubChem CID 144867470) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[phenoxy(propan-2-yl)amino]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[phenoxy(propan-2-yl)amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144867470 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[phenoxy(propan-2-yl)amino]methyl]phenyl]propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)c2ccc(C)c(CN(Oc3ccccc3)C(C)C)c2)cc(N)c1N(C)N |
| InChI | InChI=1S/C28H36N4O4/c1-18(2)32(36-23-9-7-6-8-10-23)17-22-13-20(12-11-19(22)3)24(16-27(33)34)21-14-25(29)28(31(4)30)26(15-21)35-5/h6-15,18,24H,16-17,29-30H2,1-5H3,(H,33,34) |
| InChIKey | SEMGWXMQTQIUJC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|