C35H47N5O5S — CID 146312626
3-[3-[[7-(5-acetamidopentyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid (PubChem CID 146312626) has the molecular formula C35H47N5O5S and a molecular weight of 649.86 g/mol. Its IUPAC name is 3-[3-[[7-(5-acetamidopentyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid.
| Compound Name | 3-[3-[[7-(5-acetamidopentyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 146312626 |
| Molecular Formula | C35H47N5O5S |
| Molecular Weight | 649.86 g/mol |
| Exact Mass | 649.33 |
| IUPAC Name | 3-[3-[[7-(5-acetamidopentyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)c2ccc(C)c(CN3CC(C)Oc4cc(CCCCCNC(C)=O)ccc4S3)c2)cc(N)c1N(C)N |
| InChI | InChI=1S/C35H47N5O5S/c1-22-10-12-26(29(19-34(42)43)27-17-30(36)35(39(4)37)32(18-27)44-5)16-28(22)21-40-20-23(2)45-31-15-25(11-13-33(31)46-40)9-7-6-8-14-38-24(3)41/h10-13,15-18,23,29H,6-9,14,19-21,36-37H2,1-5H3,(H,38,41)(H,42,43) |
| InChIKey | HGGGCLOZYRQZSX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.86 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|