C37H53N5O6S — CID 176993253
ethyl 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[7-(2-piperidin-4-yloxyethoxy)-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoate;methane (PubChem CID 176993253) has the molecular formula C37H53N5O6S and a molecular weight of 695.93 g/mol. Its IUPAC name is ethyl 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[7-(2-piperidin-4-yloxyethoxy)-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoate;methane.
| Compound Name | ethyl 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[7-(2-piperidin-4-yloxyethoxy)-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoate;methane |
|---|---|
| PubChem CID | 176993253 |
| Molecular Formula | C37H53N5O6S |
| Molecular Weight | 695.93 g/mol |
| Exact Mass | 695.37 |
| IUPAC Name | ethyl 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[4-methyl-3-[[7-(2-piperidin-4-yloxyethoxy)-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]phenyl]propanoate;methane |
| SMILES | C.CCOC(=O)CC(c1ccc(C)c(CN2CCOc3cc(OCCOC4CCNCC4)ccc3S2)c1)c1cc(N)c(N(C)N)c(OC)c1 |
| InChI | InChI=1S/C36H49N5O6S.CH4/c1-5-44-35(42)22-30(26-19-31(37)36(40(3)38)33(20-26)43-4)25-7-6-24(2)27(18-25)23-41-14-15-47-32-21-29(8-9-34(32)48-41)46-17-16-45-28-10-12-39-13-11-28;/h6-9,18-21,28,30,39H,5,10-17,22-23,37-38H2,1-4H3;1H4 |
| InChIKey | MLWDSWNMIANSQM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.93 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|