C12H27N — CID 144868102
ethane;4-ethyl-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 144868102) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is ethane;4-ethyl-1-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;4-ethyl-1-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 144868102 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | ethane;4-ethyl-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC.CCC1=CCN(C)CC1 |
| InChI | InChI=1S/C8H15N.2C2H6/c1-3-8-4-6-9(2)7-5-8;2*1-2/h4H,3,5-7H2,1-2H3;2*1-2H3 |
| InChIKey | LRFBSRPSWKKAKL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|