C24H38N6O4 — CID 144869378
2-amino-6-[[1-(1,3-diaminopropan-2-ylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3,3,5,5-tetramethyl-6-oxohexanoic acid (PubChem CID 144869378) has the molecular formula C24H38N6O4 and a molecular weight of 474.61 g/mol. Its IUPAC name is 2-amino-6-[[1-(1,3-diaminopropan-2-ylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3,3,5,5-tetramethyl-6-oxohexanoic acid.
| Compound Name | 2-amino-6-[[1-(1,3-diaminopropan-2-ylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3,3,5,5-tetramethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 144869378 |
| Molecular Formula | C24H38N6O4 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2-amino-6-[[1-(1,3-diaminopropan-2-ylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3,3,5,5-tetramethyl-6-oxohexanoic acid |
| SMILES | CC(C)(CC(C)(C)C(N)C(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CN)CN |
| InChI | InChI=1S/C24H38N6O4/c1-23(2,19(27)21(32)33)13-24(3,4)22(34)30-18(20(31)29-15(10-25)11-26)9-14-12-28-17-8-6-5-7-16(14)17/h5-8,12,15,18-19,28H,9-11,13,25-27H2,1-4H3,(H,29,31)(H,30,34)(H,32,33) |
| InChIKey | TXWLYFXYRZWVFC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 189.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |