C26H31FN2O4 — CID 144870071
7-fluoro-6-hydroxy-2-[(E)-2-[4-[[3-[2-(methylamino)ethoxy]phenoxy]methyl]cyclohexyl]ethenyl]-3H-isoindol-1-one (PubChem CID 144870071) has the molecular formula C26H31FN2O4 and a molecular weight of 454.54 g/mol. Its IUPAC name is 7-fluoro-6-hydroxy-2-[(E)-2-[4-[[3-[2-(methylamino)ethoxy]phenoxy]methyl]cyclohexyl]ethenyl]-3H-isoindol-1-one.
| Compound Name | 7-fluoro-6-hydroxy-2-[(E)-2-[4-[[3-[2-(methylamino)ethoxy]phenoxy]methyl]cyclohexyl]ethenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 144870071 |
| Molecular Formula | C26H31FN2O4 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 7-fluoro-6-hydroxy-2-[(E)-2-[4-[[3-[2-(methylamino)ethoxy]phenoxy]methyl]cyclohexyl]ethenyl]-3H-isoindol-1-one |
| SMILES | CNCCOc1cccc(OCC2CCC(/C=C/N3Cc4ccc(O)c(F)c4C3=O)CC2)c1 |
| InChI | InChI=1S/C26H31FN2O4/c1-28-12-14-32-21-3-2-4-22(15-21)33-17-19-7-5-18(6-8-19)11-13-29-16-20-9-10-23(30)25(27)24(20)26(29)31/h2-4,9-11,13,15,18-19,28,30H,5-8,12,14,16-17H2,1H3/b13-11+ |
| InChIKey | GQLGSHXUDJXQMG-ACCUITESSA-N |
| XLogP | 4.48 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|