C40H43FN2O6 — CID 118161049
benzyl N-[2-[3-[1-[4-[(4-fluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)methyl]cyclohexyl]ethoxy]phenoxy]ethyl]carbamate (PubChem CID 118161049) has the molecular formula C40H43FN2O6 and a molecular weight of 666.79 g/mol. Its IUPAC name is benzyl N-[2-[3-[1-[4-[(4-fluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)methyl]cyclohexyl]ethoxy]phenoxy]ethyl]carbamate.
| Compound Name | benzyl N-[2-[3-[1-[4-[(4-fluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)methyl]cyclohexyl]ethoxy]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 118161049 |
| Molecular Formula | C40H43FN2O6 |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.31 |
| IUPAC Name | benzyl N-[2-[3-[1-[4-[(4-fluoro-3-oxo-5-phenylmethoxy-1H-isoindol-2-yl)methyl]cyclohexyl]ethoxy]phenoxy]ethyl]carbamate |
| SMILES | CC(Oc1cccc(OCCNC(=O)OCc2ccccc2)c1)C1CCC(CN2Cc3ccc(OCc4ccccc4)c(F)c3C2=O)CC1 |
| InChI | InChI=1S/C40H43FN2O6/c1-28(49-35-14-8-13-34(23-35)46-22-21-42-40(45)48-27-31-11-6-3-7-12-31)32-17-15-29(16-18-32)24-43-25-33-19-20-36(38(41)37(33)39(43)44)47-26-30-9-4-2-5-10-30/h2-14,19-20,23,28-29,32H,15-18,21-22,24-27H2,1H3,(H,42,45) |
| InChIKey | GZCXWVILTNMRKY-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|