About 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane
2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane (PubChem CID 144871937) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane.
Analyze 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane?
The IUPAC name of 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane (CID 144871937) is 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane.
What is the SMILES notation for 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane?
The canonical SMILES for 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane is CC.CC1=CC=CN2CC(C)N=C12.
What is the InChIKey of 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane?
The InChIKey is YJYIMQQMFNRIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.C2H6/c1-7-4-3-5-11-6-8(2)10-9(7)11;1-2/h3-5,8H,6H2,1-2H3;1-2H3.
What are the key properties of 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane?
2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane has a molecular weight of 178.28 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-2,3-dihydroimidazo[1,2-a]pyridine;ethane is sourced from PubChem (CID 144871937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).